About ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol
ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol (PubChem CID 166157690) has the molecular formula C11H24FNO2
and a molecular weight of 221.32 g/mol. Its IUPAC name is ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol |
| PubChem CID | 166157690 |
| Molecular Formula | C11H24FNO2 |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol |
| SMILES | CC.CF.OC[C@@H]1CCN(C2COC2)C1 |
| InChI | InChI=1S/C8H15NO2.C2H6.CH3F/c10-4-7-1-2-9(3-7)8-5-11-6-8;2*1-2/h7-8,10H,1-6H2;1-2H3;1H3/t7-;;/m1../s1 |
| InChIKey | YAWBIXOAPHKRSC-XCUBXKJBSA-N |
| XLogP | 1.31 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol?
The IUPAC name of ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol (CID 166157690) is ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol.
What is the SMILES notation for ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol?
The canonical SMILES for ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol is CC.CF.OC[C@@H]1CCN(C2COC2)C1.
What is the InChIKey of ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol?
The InChIKey is YAWBIXOAPHKRSC-XCUBXKJBSA-N. The full InChI is InChI=1S/C8H15NO2.C2H6.CH3F/c10-4-7-1-2-9(3-7)8-5-11-6-8;2*1-2/h7-8,10H,1-6H2;1-2H3;1H3/t7-;;/m1../s1.
What are the key properties of ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol?
ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol has a molecular weight of 221.32 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoromethane;[(3R)-1-(oxetan-3-yl)pyrrolidin-3-yl]methanol is sourced from PubChem (CID 166157690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).