About N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen
N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen (PubChem CID 166157744) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen.
Molecular Properties
| Compound Name | N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen |
| PubChem CID | 166157744 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen |
| SMILES | CNCOCc1ccccc1C1(C)CCCN1.[H][H] |
| InChI | InChI=1S/C14H22N2O.H2/c1-14(8-5-9-16-14)13-7-4-3-6-12(13)10-17-11-15-2;/h3-4,6-7,15-16H,5,8-11H2,1-2H3;1H |
| InChIKey | WUXPJYMZLVRREP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen?
The IUPAC name of N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen (CID 166157744) is N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen.
What is the SMILES notation for N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen?
The canonical SMILES for N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen is CNCOCc1ccccc1C1(C)CCCN1.[H][H].
What is the InChIKey of N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen?
The InChIKey is WUXPJYMZLVRREP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O.H2/c1-14(8-5-9-16-14)13-7-4-3-6-12(13)10-17-11-15-2;/h3-4,6-7,15-16H,5,8-11H2,1-2H3;1H.
What are the key properties of N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen?
N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen has a molecular weight of 236.36 g/mol, XLogP of 2.22, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[[2-(2-methylpyrrolidin-2-yl)phenyl]methoxy]methanamine;molecular hydrogen is sourced from PubChem (CID 166157744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).