About (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine
(1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine (PubChem CID 166158127) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine |
| PubChem CID | 166158127 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine |
| SMILES | C=CN[C@@H]1C=CC(F)=CCC1C |
| InChI | InChI=1S/C10H14FN/c1-3-12-10-7-6-9(11)5-4-8(10)2/h3,5-8,10,12H,1,4H2,2H3/t8?,10-/m1/s1 |
| InChIKey | IFOJMEKBYMMSAS-LHIURRSHSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine?
The IUPAC name of (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine (CID 166158127) is (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine.
What is the SMILES notation for (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine?
The canonical SMILES for (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine is C=CN[C@@H]1C=CC(F)=CCC1C.
What is the InChIKey of (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine?
The InChIKey is IFOJMEKBYMMSAS-LHIURRSHSA-N. The full InChI is InChI=1S/C10H14FN/c1-3-12-10-7-6-9(11)5-4-8(10)2/h3,5-8,10,12H,1,4H2,2H3/t8?,10-/m1/s1.
What are the key properties of (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine?
(1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine has a molecular weight of 167.23 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-ethenyl-4-fluoro-7-methylcyclohepta-2,4-dien-1-amine is sourced from PubChem (CID 166158127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).