C14H17F3N2O2 — CID 166158628
methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate (PubChem CID 166158628) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate.
| Compound Name | methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate |
|---|---|
| PubChem CID | 166158628 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2CN(CC(F)(F)F)CCN2)cc1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-21-13(20)11-4-2-10(3-5-11)12-8-19(7-6-18-12)9-14(15,16)17/h2-5,12,18H,6-9H2,1H3 |
| InChIKey | FSGSJOFWNDQREU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |