About methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate
methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate (PubChem CID 166158628) has the molecular formula C14H17F3N2O2
and a molecular weight of 302.30 g/mol. Its IUPAC name is methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate |
| PubChem CID | 166158628 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2CN(CC(F)(F)F)CCN2)cc1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-21-13(20)11-4-2-10(3-5-11)12-8-19(7-6-18-12)9-14(15,16)17/h2-5,12,18H,6-9H2,1H3 |
| InChIKey | FSGSJOFWNDQREU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate?
The IUPAC name of methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate (CID 166158628) is methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate.
What is the SMILES notation for methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate?
The canonical SMILES for methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate is COC(=O)c1ccc(C2CN(CC(F)(F)F)CCN2)cc1.
What is the InChIKey of methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate?
The InChIKey is FSGSJOFWNDQREU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F3N2O2/c1-21-13(20)11-4-2-10(3-5-11)12-8-19(7-6-18-12)9-14(15,16)17/h2-5,12,18H,6-9H2,1H3.
What are the key properties of methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate?
methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate has a molecular weight of 302.30 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(2,2,2-trifluoroethyl)piperazin-2-yl]benzoate is sourced from PubChem (CID 166158628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).