C23H26F4N2O5 — CID 166158880
(2S,3R,4R,5S)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166158880) has the molecular formula C23H26F4N2O5 and a molecular weight of 486.46 g/mol. Its IUPAC name is (2S,3R,4R,5S)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166158880 |
| Molecular Formula | C23H26F4N2O5 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (2S,3R,4R,5S)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccc([C@H](O)CO)nc3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1C |
| InChI | InChI=1S/C23H26F4N2O5/c1-11-15(24)7-6-14(19(11)33-4)18-12(2)22(3,23(25,26)27)34-20(18)21(32)29-13-5-8-16(28-9-13)17(31)10-30/h5-9,12,17-18,20,30-31H,10H2,1-4H3,(H,29,32)/t12-,17-,18-,20+,22+/m1/s1 |
| InChIKey | MUKACRVXAPKIKP-VJZTYIJDSA-N |
| XLogP | 3.64 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |