C23H24F6N2O5 — CID 166158895
(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-fluoroethoxy)phenyl]-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166158895) has the molecular formula C23H24F6N2O5 and a molecular weight of 522.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-fluoroethoxy)phenyl]-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-fluoroethoxy)phenyl]-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166158895 |
| Molecular Formula | C23H24F6N2O5 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-fluoroethoxy)phenyl]-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OCCF)[C@H](C(=O)Nc2ccc([C@@H](O)CO)nc2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C23H24F6N2O5/c1-11-17(13-4-5-14(25)18(26)19(13)35-8-7-24)20(36-22(11,2)23(27,28)29)21(34)31-12-3-6-15(30-9-12)16(33)10-32/h3-6,9,11,16-17,20,32-33H,7-8,10H2,1-2H3,(H,31,34)/t11-,16-,17-,20+,22+/m0/s1 |
| InChIKey | UJCBHUWBXDXLPK-XHUREXFTSA-N |
| XLogP | 3.81 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |