C22H23F5N2O6 — CID 166158898
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-1-oxidopyridin-1-ium-3-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166158898) has the molecular formula C22H23F5N2O6 and a molecular weight of 506.42 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-1-oxidopyridin-1-ium-3-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-1-oxidopyridin-1-ium-3-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166158898 |
| Molecular Formula | C22H23F5N2O6 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-1-oxidopyridin-1-ium-3-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc([C@@H](O)CO)[n+]([O-])c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C22H23F5N2O6/c1-10-16(12-5-6-13(23)17(24)18(12)34-3)19(35-21(10,2)22(25,26)27)20(32)28-11-4-7-14(15(31)9-30)29(33)8-11/h4-8,10,15-16,19,30-31H,9H2,1-3H3,(H,28,32)/t10-,15-,16-,19+,21+/m0/s1 |
| InChIKey | YNBCEXDQCDSLKY-PEHJGKTGSA-N |
| XLogP | 2.71 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|