C24H28F4N2O5 — CID 166158906
(2R,3S,4S,5R)-N-[6-[(1R,2R)-1,2-dihydroxypropyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166158906) has the molecular formula C24H28F4N2O5 and a molecular weight of 500.49 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[6-[(1R,2R)-1,2-dihydroxypropyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[6-[(1R,2R)-1,2-dihydroxypropyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166158906 |
| Molecular Formula | C24H28F4N2O5 |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (2R,3S,4S,5R)-N-[6-[(1R,2R)-1,2-dihydroxypropyl]-3-pyridinyl]-3-(4-fluoro-2-methoxy-3-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc([C@@H](O)[C@@H](C)O)nc3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1C |
| InChI | InChI=1S/C24H28F4N2O5/c1-11-16(25)8-7-15(20(11)34-5)18-12(2)23(4,24(26,27)28)35-21(18)22(33)30-14-6-9-17(29-10-14)19(32)13(3)31/h6-10,12-13,18-19,21,31-32H,1-5H3,(H,30,33)/t12-,13+,18-,19-,21+,23+/m0/s1 |
| InChIKey | ZPIBZRGSONWVQY-MKSQZHAASA-N |
| XLogP | 4.03 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |