C22H22F6N2O4 — CID 166158923
(2R,3S,4S,5R)-3-[3-(difluoromethyl)-4-fluoro-2-methoxyphenyl]-N-[6-(hydroxymethyl)-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166158923) has the molecular formula C22H22F6N2O4 and a molecular weight of 492.42 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3-(difluoromethyl)-4-fluoro-2-methoxyphenyl]-N-[6-(hydroxymethyl)-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3-(difluoromethyl)-4-fluoro-2-methoxyphenyl]-N-[6-(hydroxymethyl)-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166158923 |
| Molecular Formula | C22H22F6N2O4 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3-(difluoromethyl)-4-fluoro-2-methoxyphenyl]-N-[6-(hydroxymethyl)-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc(CO)nc3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1C(F)F |
| InChI | InChI=1S/C22H22F6N2O4/c1-10-15(13-6-7-14(23)16(19(24)25)17(13)33-3)18(34-21(10,2)22(26,27)28)20(32)30-11-4-5-12(9-31)29-8-11/h4-8,10,15,18-19,31H,9H2,1-3H3,(H,30,32)/t10-,15-,18+,21+/m0/s1 |
| InChIKey | GAGNLAGOAUGALF-TZDAZOALSA-N |
| XLogP | 4.74 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |