C21H21F5N2O5 — CID 166158979
(2S,3R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166158979) has the molecular formula C21H21F5N2O5 and a molecular weight of 476.40 g/mol. Its IUPAC name is (2S,3R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166158979 |
| Molecular Formula | C21H21F5N2O5 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (2S,3R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S)-1,2-dihydroxyethyl]-3-pyridinyl]-5-methyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2C[C@@](C)(C(F)(F)F)O[C@@H]2C(=O)Nc2ccc([C@H](O)CO)nc2)ccc(F)c1F |
| InChI | InChI=1S/C21H21F5N2O5/c1-20(21(24,25)26)7-12(11-4-5-13(22)16(23)17(11)32-2)18(33-20)19(31)28-10-3-6-14(27-8-10)15(30)9-29/h3-6,8,12,15,18,29-30H,7,9H2,1-2H3,(H,28,31)/t12-,15-,18+,20+/m1/s1 |
| InChIKey | XBNNBHKCSFTZRO-OKAUFMRTSA-N |
| XLogP | 3.23 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |