C23H25F5N2O5 — CID 166158984
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S,2S)-1,2-dihydroxypropyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166158984) has the molecular formula C23H25F5N2O5 and a molecular weight of 504.45 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S,2S)-1,2-dihydroxypropyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S,2S)-1,2-dihydroxypropyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166158984 |
| Molecular Formula | C23H25F5N2O5 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1S,2S)-1,2-dihydroxypropyl]-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc([C@H](O)[C@H](C)O)nc3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C23H25F5N2O5/c1-10-16(13-6-7-14(24)17(25)19(13)34-4)20(35-22(10,3)23(26,27)28)21(33)30-12-5-8-15(29-9-12)18(32)11(2)31/h5-11,16,18,20,31-32H,1-4H3,(H,30,33)/t10-,11-,16-,18+,20+,22+/m0/s1 |
| InChIKey | ZTSBXTKKRQFMHI-NYLNCXSWSA-N |
| XLogP | 3.86 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |