C23H25F5N2O4 — CID 166159012
(2R,3S,4S,5R)-3-[4-fluoro-3-(1-fluoroethyl)-2-methoxyphenyl]-N-[6-(hydroxymethyl)-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166159012) has the molecular formula C23H25F5N2O4 and a molecular weight of 488.45 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[4-fluoro-3-(1-fluoroethyl)-2-methoxyphenyl]-N-[6-(hydroxymethyl)-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[4-fluoro-3-(1-fluoroethyl)-2-methoxyphenyl]-N-[6-(hydroxymethyl)-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166159012 |
| Molecular Formula | C23H25F5N2O4 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-[4-fluoro-3-(1-fluoroethyl)-2-methoxyphenyl]-N-[6-(hydroxymethyl)-3-pyridinyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccc(CO)nc3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1C(C)F |
| InChI | InChI=1S/C23H25F5N2O4/c1-11-17(15-7-8-16(25)18(12(2)24)19(15)33-4)20(34-22(11,3)23(26,27)28)21(32)30-13-5-6-14(10-31)29-9-13/h5-9,11-12,17,20,31H,10H2,1-4H3,(H,30,32)/t11-,12?,17-,20+,22+/m0/s1 |
| InChIKey | VYJLFGPEQRDVHB-SPXOPPMNSA-N |
| XLogP | 4.83 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |