C27H31F5N4O5 — CID 166159381
4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-N-[(3S,4R)-4-methoxypiperidin-3-yl]pyridine-2-carboxamide (PubChem CID 166159381) has the molecular formula C27H31F5N4O5 and a molecular weight of 586.56 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-N-[(3S,4R)-4-methoxypiperidin-3-yl]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-N-[(3S,4R)-4-methoxypiperidin-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166159381 |
| Molecular Formula | C27H31F5N4O5 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]-N-[(3S,4R)-4-methoxypiperidin-3-yl]pyridine-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3ccnc(C(=O)N[C@H]4CNCC[C@H]4OC)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C27H31F5N4O5/c1-13-20(15-5-6-16(28)21(29)22(15)40-4)23(41-26(13,2)27(30,31)32)25(38)35-14-7-10-34-17(11-14)24(37)36-18-12-33-9-8-19(18)39-3/h5-7,10-11,13,18-20,23,33H,8-9,12H2,1-4H3,(H,36,37)(H,34,35,38)/t13-,18-,19+,20-,23+,26+/m0/s1 |
| InChIKey | JHTAPNYNQKDLEO-PPUVRVGBSA-N |
| XLogP | 3.55 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |