C24H22F5N5O4 — CID 166159921
4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(1H-pyrazol-4-ylmethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 166159921) has the molecular formula C24H22F5N5O4 and a molecular weight of 539.46 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(1H-pyrazol-4-ylmethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(1H-pyrazol-4-ylmethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166159921 |
| Molecular Formula | C24H22F5N5O4 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3-[3,4-difluoro-2-(1H-pyrazol-4-ylmethoxy)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OCc2cn[nH]c2)[C@H](C(=O)Nc2ccnc(C(N)=O)c2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C24H22F5N5O4/c1-11-17(14-3-4-15(25)18(26)19(14)37-10-12-8-32-33-9-12)20(38-23(11,2)24(27,28)29)22(36)34-13-5-6-31-16(7-13)21(30)35/h3-9,11,17,20H,10H2,1-2H3,(H2,30,35)(H,32,33)(H,31,34,36)/t11-,17-,20+,23+/m0/s1 |
| InChIKey | IZFQYIVRGMUGIV-LBOCZGAHSA-N |
| XLogP | 3.84 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |