C12H18F2O — CID 166159976
butane;1,2-difluoro-3-methoxy-4-methylbenzene (PubChem CID 166159976) has the molecular formula C12H18F2O and a molecular weight of 216.27 g/mol. Its IUPAC name is butane;1,2-difluoro-3-methoxy-4-methylbenzene.
| Compound Name | butane;1,2-difluoro-3-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 166159976 |
| Molecular Formula | C12H18F2O |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | butane;1,2-difluoro-3-methoxy-4-methylbenzene |
| SMILES | CCCC.COc1c(C)ccc(F)c1F |
| InChI | InChI=1S/C8H8F2O.C4H10/c1-5-3-4-6(9)7(10)8(5)11-2;1-3-4-2/h3-4H,1-2H3;3-4H2,1-2H3 |
| InChIKey | LWAKSBXDKCVYMC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |