About 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one
8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one (PubChem CID 166160134) has the molecular formula C15H10BrCl2N3OS
and a molecular weight of 431.14 g/mol. Its IUPAC name is 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 166160134 |
| Molecular Formula | C15H10BrCl2N3OS |
| Molecular Weight | 431.14 g/mol |
| Exact Mass | 428.91 |
| IUPAC Name | 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one |
| SMILES | CSc1ncc2c(=O)n(-c3c(Cl)ccc(C)c3Cl)cc(Br)c2n1 |
| InChI | InChI=1S/C15H10BrCl2N3OS/c1-7-3-4-10(17)13(11(7)18)21-6-9(16)12-8(14(21)22)5-19-15(20-12)23-2/h3-6H,1-2H3 |
| InChIKey | HECJUUWMVGBGSH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.14 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one (CID 166160134) is 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one is CSc1ncc2c(=O)n(-c3c(Cl)ccc(C)c3Cl)cc(Br)c2n1.
What is the InChIKey of 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The InChIKey is HECJUUWMVGBGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrCl2N3OS/c1-7-3-4-10(17)13(11(7)18)21-6-9(16)12-8(14(21)22)5-19-15(20-12)23-2/h3-6H,1-2H3.
What are the key properties of 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one has a molecular weight of 431.14 g/mol, XLogP of 4.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-(2,6-dichloro-3-methylphenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 166160134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).