C26H27F5N2O5 — CID 166160142
(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-oxoethoxy)phenyl]-4,5-dimethyl-N-[2-methyl-5-[(3S)-oxolan-3-yl]-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160142) has the molecular formula C26H27F5N2O5 and a molecular weight of 542.50 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-oxoethoxy)phenyl]-4,5-dimethyl-N-[2-methyl-5-[(3S)-oxolan-3-yl]-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-oxoethoxy)phenyl]-4,5-dimethyl-N-[2-methyl-5-[(3S)-oxolan-3-yl]-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160142 |
| Molecular Formula | C26H27F5N2O5 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-oxoethoxy)phenyl]-4,5-dimethyl-N-[2-methyl-5-[(3S)-oxolan-3-yl]-3-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | Cc1ncc([C@@H]2CCOC2)cc1NC(=O)[C@@H]1O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]1c1ccc(F)c(F)c1OCC=O |
| InChI | InChI=1S/C26H27F5N2O5/c1-13-20(17-4-5-18(27)21(28)22(17)37-9-7-34)23(38-25(13,3)26(29,30)31)24(35)33-19-10-16(11-32-14(19)2)15-6-8-36-12-15/h4-5,7,10-11,13,15,20,23H,6,8-9,12H2,1-3H3,(H,33,35)/t13-,15+,20-,23+,25+/m0/s1 |
| InChIKey | RAHSLVYZOCFRPJ-BJWNIDKLSA-N |
| XLogP | 4.83 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|