C23H28F5N3O5 — CID 166160190
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[1-[(2R)-2-hydroxy-3-methoxypropyl]-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160190) has the molecular formula C23H28F5N3O5 and a molecular weight of 521.48 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[1-[(2R)-2-hydroxy-3-methoxypropyl]-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[1-[(2R)-2-hydroxy-3-methoxypropyl]-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160190 |
| Molecular Formula | C23H28F5N3O5 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[1-[(2R)-2-hydroxy-3-methoxypropyl]-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COC[C@H](O)Cn1cc(NC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)c(C)n1 |
| InChI | InChI=1S/C23H28F5N3O5/c1-11-17(14-6-7-15(24)18(25)19(14)35-5)20(36-22(11,3)23(26,27)28)21(33)29-16-9-31(30-12(16)2)8-13(32)10-34-4/h6-7,9,11,13,17,20,32H,8,10H2,1-5H3,(H,29,33)/t11-,13+,17-,20+,22+/m0/s1 |
| InChIKey | YVNXEILHWZKQLN-ZHPKVPOWSA-N |
| XLogP | 3.56 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |