C22H24F5N3O5 — CID 166160257
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(2-methoxyethoxy)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160257) has the molecular formula C22H24F5N3O5 and a molecular weight of 505.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(2-methoxyethoxy)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(2-methoxyethoxy)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160257 |
| Molecular Formula | C22H24F5N3O5 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(2-methoxyethoxy)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COCCOc1cc(NC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)cnn1 |
| InChI | InChI=1S/C22H24F5N3O5/c1-11-16(13-5-6-14(23)17(24)18(13)33-4)19(35-21(11,2)22(25,26)27)20(31)29-12-9-15(30-28-10-12)34-8-7-32-3/h5-6,9-11,16,19H,7-8H2,1-4H3,(H,29,30,31)/t11-,16-,19+,21+/m0/s1 |
| InChIKey | USUNNVAFVSQHQO-YFVHLLGCSA-N |
| XLogP | 3.87 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|