C19H16F7N3O3 — CID 166160333
(2R,3S,4S,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-N-pyridazin-4-yl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160333) has the molecular formula C19H16F7N3O3 and a molecular weight of 467.34 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-N-pyridazin-4-yl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-N-pyridazin-4-yl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160333 |
| Molecular Formula | C19H16F7N3O3 |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (2R,3S,4S,5R)-3-[2-(difluoromethoxy)-3,4-difluorophenyl]-4,5-dimethyl-N-pyridazin-4-yl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OC(F)F)[C@H](C(=O)Nc2ccnnc2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C19H16F7N3O3/c1-8-12(10-3-4-11(20)13(21)14(10)31-17(22)23)15(32-18(8,2)19(24,25)26)16(30)29-9-5-6-27-28-7-9/h3-8,12,15,17H,1-2H3,(H,27,29,30)/t8-,12-,15+,18+/m0/s1 |
| InChIKey | FMQHRINDWKUWMN-VSVZXFICSA-N |
| XLogP | 4.43 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |