C20H20F5N3O4 — CID 166160354
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(hydroxymethyl)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160354) has the molecular formula C20H20F5N3O4 and a molecular weight of 461.39 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(hydroxymethyl)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(hydroxymethyl)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160354 |
| Molecular Formula | C20H20F5N3O4 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[6-(hydroxymethyl)pyridazin-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cnnc(CO)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H20F5N3O4/c1-9-14(12-4-5-13(21)15(22)16(12)31-3)17(32-19(9,2)20(23,24)25)18(30)27-10-6-11(8-29)28-26-7-10/h4-7,9,14,17,29H,8H2,1-3H3,(H,27,28,30)/t9-,14-,17+,19+/m0/s1 |
| InChIKey | XOHVHIREASKEHV-IUWPEGGASA-N |
| XLogP | 3.33 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |