C22H25F5N4O5 — CID 166160363
(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-[1-(oxolan-3-yl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160363) has the molecular formula C22H25F5N4O5 and a molecular weight of 520.46 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-[1-(oxolan-3-yl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-[1-(oxolan-3-yl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160363 |
| Molecular Formula | C22H25F5N4O5 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-[1-(oxolan-3-yl)-1,2,4-triazol-3-yl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OCCO)[C@H](C(=O)Nc2ncn(C3CCOC3)n2)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C22H25F5N4O5/c1-11-15(13-3-4-14(23)16(24)17(13)35-8-6-32)18(36-21(11,2)22(25,26)27)19(33)29-20-28-10-31(30-20)12-5-7-34-9-12/h3-4,10-12,15,18,32H,5-9H2,1-2H3,(H,29,30,33)/t11-,12?,15-,18+,21+/m0/s1 |
| InChIKey | WLAPARWKSIBSKA-BXDFCPHOSA-N |
| XLogP | 2.97 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |