C24H28F5N3O4 — CID 166160415
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[3-methyl-1-(oxan-4-yl)pyrazol-4-yl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160415) has the molecular formula C24H28F5N3O4 and a molecular weight of 517.50 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[3-methyl-1-(oxan-4-yl)pyrazol-4-yl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[3-methyl-1-(oxan-4-yl)pyrazol-4-yl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160415 |
| Molecular Formula | C24H28F5N3O4 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[3-methyl-1-(oxan-4-yl)pyrazol-4-yl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cn(C4CCOCC4)nc3C)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C24H28F5N3O4/c1-12-18(15-5-6-16(25)19(26)20(15)34-4)21(36-23(12,3)24(27,28)29)22(33)30-17-11-32(31-13(17)2)14-7-9-35-10-8-14/h5-6,11-12,14,18,21H,7-10H2,1-4H3,(H,30,33)/t12-,18-,21+,23+/m0/s1 |
| InChIKey | LWUIPUAMWKHBAO-IUCRBNCASA-N |
| XLogP | 4.91 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |