C21H26F2N2O5 — CID 166160438
1,2-difluoro-3-(2-methoxyethoxy)benzene;5-methyl-N-(1-methyl-6-oxo-3-pyridinyl)oxolane-2-carboxamide (PubChem CID 166160438) has the molecular formula C21H26F2N2O5 and a molecular weight of 424.44 g/mol. Its IUPAC name is 1,2-difluoro-3-(2-methoxyethoxy)benzene;5-methyl-N-(1-methyl-6-oxo-3-pyridinyl)oxolane-2-carboxamide.
| Compound Name | 1,2-difluoro-3-(2-methoxyethoxy)benzene;5-methyl-N-(1-methyl-6-oxo-3-pyridinyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160438 |
| Molecular Formula | C21H26F2N2O5 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1,2-difluoro-3-(2-methoxyethoxy)benzene;5-methyl-N-(1-methyl-6-oxo-3-pyridinyl)oxolane-2-carboxamide |
| SMILES | CC1CCC(C(=O)Nc2ccc(=O)n(C)c2)O1.COCCOc1cccc(F)c1F |
| InChI | InChI=1S/C12H16N2O3.C9H10F2O2/c1-8-3-5-10(17-8)12(16)13-9-4-6-11(15)14(2)7-9;1-12-5-6-13-8-4-2-3-7(10)9(8)11/h4,6-8,10H,3,5H2,1-2H3,(H,13,16);2-4H,5-6H2,1H3 |
| InChIKey | VLIKJCIIUILXED-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|