C21H25F2N3O3 — CID 166160462
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[(2R)-2-(1-methylpyrazol-4-yl)cyclopropyl]oxolane-2-carboxamide (PubChem CID 166160462) has the molecular formula C21H25F2N3O3 and a molecular weight of 405.45 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[(2R)-2-(1-methylpyrazol-4-yl)cyclopropyl]oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[(2R)-2-(1-methylpyrazol-4-yl)cyclopropyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160462 |
| Molecular Formula | C21H25F2N3O3 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[(2R)-2-(1-methylpyrazol-4-yl)cyclopropyl]oxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@H](C)[C@@H](C)O[C@H]2C(=O)NC2C[C@@H]2c2cnn(C)c2)ccc(F)c1F |
| InChI | InChI=1S/C21H25F2N3O3/c1-10-11(2)29-20(17(10)13-5-6-15(22)18(23)19(13)28-4)21(27)25-16-7-14(16)12-8-24-26(3)9-12/h5-6,8-11,14,16-17,20H,7H2,1-4H3,(H,25,27)/t10-,11-,14-,16?,17+,20-/m1/s1 |
| InChIKey | SQXQXGFKVMYXTF-NDZJBCPDSA-N |
| XLogP | 2.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |