C20H20F7N3O3 — CID 166160513
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160513) has the molecular formula C20H20F7N3O3 and a molecular weight of 483.38 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160513 |
| Molecular Formula | C20H20F7N3O3 |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)Nc3cn(C(F)F)nc3C)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C20H20F7N3O3/c1-8-13(10-5-6-11(21)14(22)15(10)32-4)16(33-19(8,3)20(25,26)27)17(31)28-12-7-30(18(23)24)29-9(12)2/h5-8,13,16,18H,1-4H3,(H,28,31)/t8-,13-,16+,19+/m0/s1 |
| InChIKey | MXZNEHDYWOVAPB-CFKRIXOTSA-N |
| XLogP | 4.95 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |