C21H24F5N3O3 — CID 166160524
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166160524) has the molecular formula C21H24F5N3O3 and a molecular weight of 461.43 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166160524 |
| Molecular Formula | C21H24F5N3O3 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@H]2[C@H](C(=O)NCCc3cnn(C)c3)O[C@@](C)(C(F)(F)F)[C@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C21H24F5N3O3/c1-11-15(13-5-6-14(22)16(23)17(13)31-4)18(32-20(11,2)21(24,25)26)19(30)27-8-7-12-9-28-29(3)10-12/h5-6,9-11,15,18H,7-8H2,1-4H3,(H,27,30)/t11-,15-,18+,20+/m0/s1 |
| InChIKey | KOEIAPULCJRVBF-WCEPDNICSA-N |
| XLogP | 3.51 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |