C15H19N3O4 — CID 166161060
N-[2-(3-hydroxy-2-oxopyrrolidin-1-yl)-4-pyridinyl]-5-methyloxolane-2-carboxamide (PubChem CID 166161060) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[2-(3-hydroxy-2-oxopyrrolidin-1-yl)-4-pyridinyl]-5-methyloxolane-2-carboxamide.
| Compound Name | N-[2-(3-hydroxy-2-oxopyrrolidin-1-yl)-4-pyridinyl]-5-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 166161060 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[2-(3-hydroxy-2-oxopyrrolidin-1-yl)-4-pyridinyl]-5-methyloxolane-2-carboxamide |
| SMILES | CC1CCC(C(=O)Nc2ccnc(N3CCC(O)C3=O)c2)O1 |
| InChI | InChI=1S/C15H19N3O4/c1-9-2-3-12(22-9)14(20)17-10-4-6-16-13(8-10)18-7-5-11(19)15(18)21/h4,6,8-9,11-12,19H,2-3,5,7H2,1H3,(H,16,17,20) |
| InChIKey | ZERIANFLHQGKAI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |