C20H22F5N3O4 — CID 166161102
(2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-(2-methylpyrazol-3-yl)-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166161102) has the molecular formula C20H22F5N3O4 and a molecular weight of 463.40 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-(2-methylpyrazol-3-yl)-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-(2-methylpyrazol-3-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166161102 |
| Molecular Formula | C20H22F5N3O4 |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (2R,3S,4S,5R)-3-[3,4-difluoro-2-(2-hydroxyethoxy)phenyl]-4,5-dimethyl-N-(2-methylpyrazol-3-yl)-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OCCO)[C@H](C(=O)Nc2ccnn2C)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C20H22F5N3O4/c1-10-14(11-4-5-12(21)15(22)16(11)31-9-8-29)17(32-19(10,2)20(23,24)25)18(30)27-13-6-7-26-28(13)3/h4-7,10,14,17,29H,8-9H2,1-3H3,(H,27,30)/t10-,14-,17+,19+/m0/s1 |
| InChIKey | ZZDNHYMONVFBRB-JPGHDDERSA-N |
| XLogP | 3.15 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |