C21H24F5N3O4 — CID 166161180
(2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 166161180) has the molecular formula C21H24F5N3O4 and a molecular weight of 477.43 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166161180 |
| Molecular Formula | C21H24F5N3O4 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-2-methoxyphenyl)-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COCc1cc(CNC(=O)[C@@H]2O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]2c2ccc(F)c(F)c2OC)[nH]n1 |
| InChI | InChI=1S/C21H24F5N3O4/c1-10-15(13-5-6-14(22)16(23)17(13)32-4)18(33-20(10,2)21(24,25)26)19(30)27-8-11-7-12(9-31-3)29-28-11/h5-7,10,15,18H,8-9H2,1-4H3,(H,27,30)(H,28,29)/t10-,15-,18+,20+/m0/s1 |
| InChIKey | CYAURLRKCQGOBA-WJVRSIEWSA-N |
| XLogP | 3.60 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |