About 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine
2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine (PubChem CID 166162094) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine.
Molecular Properties
| Compound Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine |
| PubChem CID | 166162094 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine |
| SMILES | CN1CC=C(c2cc(N)c([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C11H14N4O2/c1-14-4-2-8(3-5-14)10-6-9(12)11(7-13-10)15(16)17/h2,6-7H,3-5H2,1H3,(H2,12,13) |
| InChIKey | LSAYUAJKLHMFJT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine?
The IUPAC name of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine (CID 166162094) is 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine.
What is the SMILES notation for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine?
The canonical SMILES for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine is CN1CC=C(c2cc(N)c([N+](=O)[O-])cn2)CC1.
What is the InChIKey of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine?
The InChIKey is LSAYUAJKLHMFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-14-4-2-8(3-5-14)10-6-9(12)11(7-13-10)15(16)17/h2,6-7H,3-5H2,1H3,(H2,12,13).
What are the key properties of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine?
2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine has a molecular weight of 234.26 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitropyridin-4-amine is sourced from PubChem (CID 166162094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).