About ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate
ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate (PubChem CID 166162225) has the molecular formula C16H15BrF2N2O3
and a molecular weight of 401.21 g/mol. Its IUPAC name is ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate |
| PubChem CID | 166162225 |
| Molecular Formula | C16H15BrF2N2O3 |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(Cc2c(F)cccc2F)c(Br)c1C=COC |
| InChI | InChI=1S/C16H15BrF2N2O3/c1-3-24-16(22)14-10(7-8-23-2)15(17)21(20-14)9-11-12(18)5-4-6-13(11)19/h4-8H,3,9H2,1-2H3 |
| InChIKey | SVLDQNFNETYLTB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate?
The IUPAC name of ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate (CID 166162225) is ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate?
The canonical SMILES for ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate is CCOC(=O)c1nn(Cc2c(F)cccc2F)c(Br)c1C=COC.
What is the InChIKey of ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate?
The InChIKey is SVLDQNFNETYLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrF2N2O3/c1-3-24-16(22)14-10(7-8-23-2)15(17)21(20-14)9-11-12(18)5-4-6-13(11)19/h4-8H,3,9H2,1-2H3.
What are the key properties of ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate?
ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate has a molecular weight of 401.21 g/mol, XLogP of 3.77, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-bromo-1-[(2,6-difluorophenyl)methyl]-4-(2-methoxyethenyl)pyrazole-3-carboxylate is sourced from PubChem (CID 166162225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).