About sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide
sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide (PubChem CID 166162301) has the molecular formula C14H12F3N4NaO3S
and a molecular weight of 396.33 g/mol. Its IUPAC name is sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide.
Molecular Properties
| Compound Name | sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide |
| PubChem CID | 166162301 |
| Molecular Formula | C14H12F3N4NaO3S |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide |
| SMILES | CNS(=O)(=O)Nc1nccc(Cc2cc(F)c(F)c(C([NH-])=O)c2)c1F.[Na+] |
| InChI | InChI=1S/C14H13F3N4O3S.Na/c1-19-25(23,24)21-14-11(16)8(2-3-20-14)4-7-5-9(13(18)22)12(17)10(15)6-7;/h2-3,5-6,19H,4H2,1H3,(H3,18,20,21,22);/q;+1/p-1 |
| InChIKey | ZTCANDBVTAERCN-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide?
The IUPAC name of sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide (CID 166162301) is sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide.
What is the SMILES notation for sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide?
The canonical SMILES for sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide is CNS(=O)(=O)Nc1nccc(Cc2cc(F)c(F)c(C([NH-])=O)c2)c1F.[Na+].
What is the InChIKey of sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide?
The InChIKey is ZTCANDBVTAERCN-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H13F3N4O3S.Na/c1-19-25(23,24)21-14-11(16)8(2-3-20-14)4-7-5-9(13(18)22)12(17)10(15)6-7;/h2-3,5-6,19H,4H2,1H3,(H3,18,20,21,22);/q;+1/p-1.
What are the key properties of sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide?
sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide has a molecular weight of 396.33 g/mol, XLogP of -0.84, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [2,3-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]azanide is sourced from PubChem (CID 166162301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).