About 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane
2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane (PubChem CID 166162381) has the molecular formula C11H22F2N2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane.
Molecular Properties
| Compound Name | 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane |
| PubChem CID | 166162381 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane |
| SMILES | C=C(CN)N1CC(F)(F)CC1C.CCC |
| InChI | InChI=1S/C8H14F2N2.C3H8/c1-6-3-8(9,10)5-12(6)7(2)4-11;1-3-2/h6H,2-5,11H2,1H3;3H2,1-2H3 |
| InChIKey | URUSNQOPEGEJDT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane?
The IUPAC name of 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane (CID 166162381) is 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane.
What is the SMILES notation for 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane?
The canonical SMILES for 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane is C=C(CN)N1CC(F)(F)CC1C.CCC.
What is the InChIKey of 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane?
The InChIKey is URUSNQOPEGEJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2.C3H8/c1-6-3-8(9,10)5-12(6)7(2)4-11;1-3-2/h6H,2-5,11H2,1H3;3H2,1-2H3.
What are the key properties of 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane?
2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane has a molecular weight of 220.31 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoro-2-methylpyrrolidin-1-yl)prop-2-en-1-amine;propane is sourced from PubChem (CID 166162381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).