C8H12FNO — CID 166162578
(2-fluoro-1,2,3,5-tetrahydropyrrolizin-8-yl)methanol (PubChem CID 166162578) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is (2-fluoro-1,2,3,5-tetrahydropyrrolizin-8-yl)methanol.
| Compound Name | (2-fluoro-1,2,3,5-tetrahydropyrrolizin-8-yl)methanol |
|---|---|
| PubChem CID | 166162578 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (2-fluoro-1,2,3,5-tetrahydropyrrolizin-8-yl)methanol |
| SMILES | OCC12C=CCN1CC(F)C2 |
| InChI | InChI=1S/C8H12FNO/c9-7-4-8(6-11)2-1-3-10(8)5-7/h1-2,7,11H,3-6H2 |
| InChIKey | PWFNNKKGAPEXQB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|