C10H15N3O — CID 166162665
4-methyl-2-[(3R)-piperidin-3-yl]pyridazin-3-one (PubChem CID 166162665) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-methyl-2-[(3R)-piperidin-3-yl]pyridazin-3-one.
| Compound Name | 4-methyl-2-[(3R)-piperidin-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 166162665 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4-methyl-2-[(3R)-piperidin-3-yl]pyridazin-3-one |
| SMILES | Cc1ccnn([C@@H]2CCCNC2)c1=O |
| InChI | InChI=1S/C10H15N3O/c1-8-4-6-12-13(10(8)14)9-3-2-5-11-7-9/h4,6,9,11H,2-3,5,7H2,1H3/t9-/m1/s1 |
| InChIKey | YFICGKXYZDPFTA-SECBINFHSA-N |
| XLogP | 0.48 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |