C17H16ClN5O2S — CID 166162898
4-(2-chloro-5-ethyl-4-pyridinyl)-N-(5-methoxy-1,3,4-thiadiazol-2-yl)-6-methylpyridine-3-carboxamide (PubChem CID 166162898) has the molecular formula C17H16ClN5O2S and a molecular weight of 389.87 g/mol. Its IUPAC name is 4-(2-chloro-5-ethyl-4-pyridinyl)-N-(5-methoxy-1,3,4-thiadiazol-2-yl)-6-methylpyridine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-ethyl-4-pyridinyl)-N-(5-methoxy-1,3,4-thiadiazol-2-yl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 166162898 |
| Molecular Formula | C17H16ClN5O2S |
| Molecular Weight | 389.87 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-(2-chloro-5-ethyl-4-pyridinyl)-N-(5-methoxy-1,3,4-thiadiazol-2-yl)-6-methylpyridine-3-carboxamide |
| SMILES | CCc1cnc(Cl)cc1-c1cc(C)ncc1C(=O)Nc1nnc(OC)s1 |
| InChI | InChI=1S/C17H16ClN5O2S/c1-4-10-7-20-14(18)6-11(10)12-5-9(2)19-8-13(12)15(24)21-16-22-23-17(25-3)26-16/h5-8H,4H2,1-3H3,(H,21,22,24) |
| InChIKey | MXXWOLXRSVZKME-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|