C16H11ClN6O3S — CID 166163500
5-(2-chloro-5-methoxy-4-pyridinyl)-2-cyano-N-(5-methoxy-1,3,4-thiadiazol-2-yl)pyridine-4-carboxamide (PubChem CID 166163500) has the molecular formula C16H11ClN6O3S and a molecular weight of 402.82 g/mol. Its IUPAC name is 5-(2-chloro-5-methoxy-4-pyridinyl)-2-cyano-N-(5-methoxy-1,3,4-thiadiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | 5-(2-chloro-5-methoxy-4-pyridinyl)-2-cyano-N-(5-methoxy-1,3,4-thiadiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166163500 |
| Molecular Formula | C16H11ClN6O3S |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 5-(2-chloro-5-methoxy-4-pyridinyl)-2-cyano-N-(5-methoxy-1,3,4-thiadiazol-2-yl)pyridine-4-carboxamide |
| SMILES | COc1nnc(NC(=O)c2cc(C#N)ncc2-c2cc(Cl)ncc2OC)s1 |
| InChI | InChI=1S/C16H11ClN6O3S/c1-25-12-7-20-13(17)4-9(12)11-6-19-8(5-18)3-10(11)14(24)21-15-22-23-16(26-2)27-15/h3-4,6-7H,1-2H3,(H,21,22,24) |
| InChIKey | HJYLVUVCRUAZNQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|