C6H10FN3 — CID 166164318
N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine (PubChem CID 166164318) has the molecular formula C6H10FN3 and a molecular weight of 143.16 g/mol. Its IUPAC name is N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine.
| Compound Name | N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 166164318 |
| Molecular Formula | C6H10FN3 |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine |
| SMILES | CC1=CNC(NF)=NC1C |
| InChI | InChI=1S/C6H10FN3/c1-4-3-8-6(10-7)9-5(4)2/h3,5H,1-2H3,(H2,8,9,10) |
| InChIKey | AROHBOGNNBDYFU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|