About N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine
N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine (PubChem CID 166164318) has the molecular formula C6H10FN3
and a molecular weight of 143.16 g/mol. Its IUPAC name is N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine.
Molecular Properties
| Compound Name | N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine |
| PubChem CID | 166164318 |
| Molecular Formula | C6H10FN3 |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine |
| SMILES | CC1=CNC(NF)=NC1C |
| InChI | InChI=1S/C6H10FN3/c1-4-3-8-6(10-7)9-5(4)2/h3,5H,1-2H3,(H2,8,9,10) |
| InChIKey | AROHBOGNNBDYFU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine?
The IUPAC name of N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine (CID 166164318) is N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine.
What is the SMILES notation for N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine?
The canonical SMILES for N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine is CC1=CNC(NF)=NC1C.
What is the InChIKey of N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine?
The InChIKey is AROHBOGNNBDYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FN3/c1-4-3-8-6(10-7)9-5(4)2/h3,5H,1-2H3,(H2,8,9,10).
What are the key properties of N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine?
N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine has a molecular weight of 143.16 g/mol, XLogP of 0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluoro-4,5-dimethyl-1,4-dihydropyrimidin-2-amine is sourced from PubChem (CID 166164318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).