C28H37N5O2 — CID 166164496
ethane;4-morpholin-4-yl-2-[[(3Z,5E)-6-phenylocta-3,5-dien-4-yl]amino]-5H-cyclopenta[d]pyrimidine-6-carboxamide (PubChem CID 166164496) has the molecular formula C28H37N5O2 and a molecular weight of 475.64 g/mol. Its IUPAC name is ethane;4-morpholin-4-yl-2-[[(3Z,5E)-6-phenylocta-3,5-dien-4-yl]amino]-5H-cyclopenta[d]pyrimidine-6-carboxamide.
| Compound Name | ethane;4-morpholin-4-yl-2-[[(3Z,5E)-6-phenylocta-3,5-dien-4-yl]amino]-5H-cyclopenta[d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 166164496 |
| Molecular Formula | C28H37N5O2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | ethane;4-morpholin-4-yl-2-[[(3Z,5E)-6-phenylocta-3,5-dien-4-yl]amino]-5H-cyclopenta[d]pyrimidine-6-carboxamide |
| SMILES | CC.CC/C=C(/C=C(\CC)c1ccccc1)Nc1nc2c(c(N3CCOCC3)n1)CC(C(N)=O)=C2 |
| InChI | InChI=1S/C26H31N5O2.C2H6/c1-3-8-21(15-18(4-2)19-9-6-5-7-10-19)28-26-29-23-17-20(24(27)32)16-22(23)25(30-26)31-11-13-33-14-12-31;1-2/h5-10,15,17H,3-4,11-14,16H2,1-2H3,(H2,27,32)(H,28,29,30);1-2H3/b18-15+,21-8-; |
| InChIKey | SLWFICMTEKPLHL-IDNAUUJISA-N |
| XLogP | 4.96 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|