C10H12N2 — CID 166164658
4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-pyrazole (PubChem CID 166164658) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-pyrazole.
| Compound Name | 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 166164658 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1H-pyrazole |
| SMILES | C=C/C=C\C(=C/C)c1cn[nH]c1 |
| InChI | InChI=1S/C10H12N2/c1-3-5-6-9(4-2)10-7-11-12-8-10/h3-8H,1H2,2H3,(H,11,12)/b6-5-,9-4+ |
| InChIKey | ZEXVZYIXONTSRX-CXBDEZGUSA-N |
| XLogP | 2.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|