About (Z)-2-phenylbut-2-en-1-imine;propane
(Z)-2-phenylbut-2-en-1-imine;propane (PubChem CID 166165004) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is (Z)-2-phenylbut-2-en-1-imine;propane.
Molecular Properties
| Compound Name | (Z)-2-phenylbut-2-en-1-imine;propane |
| PubChem CID | 166165004 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (Z)-2-phenylbut-2-en-1-imine;propane |
| SMILES | CCC.[H]/N=C/C(=C\C)c1ccccc1 |
| InChI | InChI=1S/C10H11N.C3H8/c1-2-9(8-11)10-6-4-3-5-7-10;1-3-2/h2-8,11H,1H3;3H2,1-2H3/b9-2+,11-8+; |
| InChIKey | BAQHVJUKHDWXBN-CITVDJSZSA-N |
| XLogP | 4.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-phenylbut-2-en-1-imine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-phenylbut-2-en-1-imine;propane?
The IUPAC name of (Z)-2-phenylbut-2-en-1-imine;propane (CID 166165004) is (Z)-2-phenylbut-2-en-1-imine;propane.
What is the SMILES notation for (Z)-2-phenylbut-2-en-1-imine;propane?
The canonical SMILES for (Z)-2-phenylbut-2-en-1-imine;propane is CCC.[H]/N=C/C(=C\C)c1ccccc1.
What is the InChIKey of (Z)-2-phenylbut-2-en-1-imine;propane?
The InChIKey is BAQHVJUKHDWXBN-CITVDJSZSA-N. The full InChI is InChI=1S/C10H11N.C3H8/c1-2-9(8-11)10-6-4-3-5-7-10;1-3-2/h2-8,11H,1H3;3H2,1-2H3/b9-2+,11-8+;.
What are the key properties of (Z)-2-phenylbut-2-en-1-imine;propane?
(Z)-2-phenylbut-2-en-1-imine;propane has a molecular weight of 189.30 g/mol, XLogP of 4.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-phenylbut-2-en-1-imine;propane is sourced from PubChem (CID 166165004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).