About ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate
ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate (PubChem CID 166165132) has the molecular formula C30H37N2O7PS
and a molecular weight of 600.67 g/mol. Its IUPAC name is ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate.
Molecular Properties
| Compound Name | ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate |
| PubChem CID | 166165132 |
| Molecular Formula | C30H37N2O7PS |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3cccs3)[nH]2)cc(OC)c1OCOP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C30H37N2O7PS/c1-29(2,3)38-40(33,39-30(4,5)6)37-19-36-27-22(34-7)17-21(18-23(27)35-8)28-31-25(20-13-10-9-11-14-20)26(32-28)24-15-12-16-41-24/h9-18H,19H2,1-8H3,(H,31,32) |
| InChIKey | APASCGDHXIRSCZ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate?
The IUPAC name of ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate (CID 166165132) is ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate.
What is the SMILES notation for ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate?
The canonical SMILES for ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate is COc1cc(-c2nc(-c3ccccc3)c(-c3cccs3)[nH]2)cc(OC)c1OCOP(=O)(OC(C)(C)C)OC(C)(C)C.
What is the InChIKey of ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate?
The InChIKey is APASCGDHXIRSCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37N2O7PS/c1-29(2,3)38-40(33,39-30(4,5)6)37-19-36-27-22(34-7)17-21(18-23(27)35-8)28-31-25(20-13-10-9-11-14-20)26(32-28)24-15-12-16-41-24/h9-18H,19H2,1-8H3,(H,31,32).
What are the key properties of ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate?
ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate has a molecular weight of 600.67 g/mol, XLogP of 8.58, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl [2,6-dimethoxy-4-(4-phenyl-5-thiophen-2-yl-1H-imidazol-2-yl)phenoxy]methyl phosphate is sourced from PubChem (CID 166165132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).