About N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide
N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide (PubChem CID 166165723) has the molecular formula C22H19FN2O2
and a molecular weight of 362.40 g/mol. Its IUPAC name is N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide |
| PubChem CID | 166165723 |
| Molecular Formula | C22H19FN2O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cccc(-c3ccc4c(c3)CCN4)c2O)cc1F |
| InChI | InChI=1S/C22H19FN2O2/c1-13(26)25-21-8-6-15(12-19(21)23)18-4-2-3-17(22(18)27)14-5-7-20-16(11-14)9-10-24-20/h2-8,11-12,24,27H,9-10H2,1H3,(H,25,26) |
| InChIKey | BSETXSQNESZIEP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide?
The IUPAC name of N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide (CID 166165723) is N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide.
What is the SMILES notation for N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide?
The canonical SMILES for N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide is CC(=O)Nc1ccc(-c2cccc(-c3ccc4c(c3)CCN4)c2O)cc1F.
What is the InChIKey of N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide?
The InChIKey is BSETXSQNESZIEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN2O2/c1-13(26)25-21-8-6-15(12-19(21)23)18-4-2-3-17(22(18)27)14-5-7-20-16(11-14)9-10-24-20/h2-8,11-12,24,27H,9-10H2,1H3,(H,25,26).
What are the key properties of N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide?
N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide has a molecular weight of 362.40 g/mol, XLogP of 4.79, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[3-(2,3-dihydro-1H-indol-5-yl)-2-hydroxyphenyl]-2-fluorophenyl]acetamide is sourced from PubChem (CID 166165723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).