C8H19N3 — CID 166166562
3,6-diazabicyclo[3.2.1]octan-3-amine;ethane (PubChem CID 166166562) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is 3,6-diazabicyclo[3.2.1]octan-3-amine;ethane.
| Compound Name | 3,6-diazabicyclo[3.2.1]octan-3-amine;ethane |
|---|---|
| PubChem CID | 166166562 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 3,6-diazabicyclo[3.2.1]octan-3-amine;ethane |
| SMILES | CC.NN1CC2CNC(C2)C1 |
| InChI | InChI=1S/C6H13N3.C2H6/c7-9-3-5-1-6(4-9)8-2-5;1-2/h5-6,8H,1-4,7H2;1-2H3 |
| InChIKey | YEOKNRMKGGBTNK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|