C24H27ClFN7O2 — CID 166167435
N-[2-chloro-4-[5-fluoro-2-hydroxy-3-(2-piperazin-1-yl-4-pyridinyl)phenyl]phenyl]-N-[2-(dimethylamino)hydrazinyl]formamide (PubChem CID 166167435) has the molecular formula C24H27ClFN7O2 and a molecular weight of 499.98 g/mol. Its IUPAC name is N-[2-chloro-4-[5-fluoro-2-hydroxy-3-(2-piperazin-1-yl-4-pyridinyl)phenyl]phenyl]-N-[2-(dimethylamino)hydrazinyl]formamide.
| Compound Name | N-[2-chloro-4-[5-fluoro-2-hydroxy-3-(2-piperazin-1-yl-4-pyridinyl)phenyl]phenyl]-N-[2-(dimethylamino)hydrazinyl]formamide |
|---|---|
| PubChem CID | 166167435 |
| Molecular Formula | C24H27ClFN7O2 |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[2-chloro-4-[5-fluoro-2-hydroxy-3-(2-piperazin-1-yl-4-pyridinyl)phenyl]phenyl]-N-[2-(dimethylamino)hydrazinyl]formamide |
| SMILES | CN(C)NNN(C=O)c1ccc(-c2cc(F)cc(-c3ccnc(N4CCNCC4)c3)c2O)cc1Cl |
| InChI | InChI=1S/C24H27ClFN7O2/c1-31(2)29-30-33(15-34)22-4-3-16(11-21(22)25)19-13-18(26)14-20(24(19)35)17-5-6-28-23(12-17)32-9-7-27-8-10-32/h3-6,11-15,27,29-30,35H,7-10H2,1-2H3 |
| InChIKey | POBMBJBEWBUGDF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|