About 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+)
7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+) (PubChem CID 166168014) has the molecular formula C16H12N2ORbRe-
and a molecular weight of 519.96 g/mol. Its IUPAC name is 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+).
Molecular Properties
| Compound Name | 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+) |
| PubChem CID | 166168014 |
| Molecular Formula | C16H12N2ORbRe- |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.96 |
| IUPAC Name | 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+) |
| SMILES | Cc1cccc2cc(C(=O)Nc3[c-]cc[c-]c3)[nH]c12.[Rb+].[Re] |
| InChI | InChI=1S/C16H12N2O.Rb.Re/c1-11-6-5-7-12-10-14(18-15(11)12)16(19)17-13-8-3-2-4-9-13;;/h2-3,5-7,9-10,18H,1H3,(H,17,19);;/q-2;+1; |
| InChIKey | RBDDVECCWHKHQG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+)?
The IUPAC name of 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+) (CID 166168014) is 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+).
What is the SMILES notation for 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+)?
The canonical SMILES for 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+) is Cc1cccc2cc(C(=O)Nc3[c-]cc[c-]c3)[nH]c12.[Rb+].[Re].
What is the InChIKey of 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+)?
The InChIKey is RBDDVECCWHKHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O.Rb.Re/c1-11-6-5-7-12-10-14(18-15(11)12)16(19)17-13-8-3-2-4-9-13;;/h2-3,5-7,9-10,18H,1H3,(H,17,19);;/q-2;+1;.
What are the key properties of 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+)?
7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+) has a molecular weight of 519.96 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-N-phenyl-1H-indole-2-carboxamide;rhenium;rubidium(1+) is sourced from PubChem (CID 166168014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).