C25H26F2N8O2S — CID 166168877
6-[3-[[ethyl(methyl)amino]sulfanylamino]-2,6-difluorophenoxy]-3-(2-piperazin-1-ylpyrimidin-5-yl)quinazolin-4-one (PubChem CID 166168877) has the molecular formula C25H26F2N8O2S and a molecular weight of 540.60 g/mol. Its IUPAC name is 6-[3-[[ethyl(methyl)amino]sulfanylamino]-2,6-difluorophenoxy]-3-(2-piperazin-1-ylpyrimidin-5-yl)quinazolin-4-one.
| Compound Name | 6-[3-[[ethyl(methyl)amino]sulfanylamino]-2,6-difluorophenoxy]-3-(2-piperazin-1-ylpyrimidin-5-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 166168877 |
| Molecular Formula | C25H26F2N8O2S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 6-[3-[[ethyl(methyl)amino]sulfanylamino]-2,6-difluorophenoxy]-3-(2-piperazin-1-ylpyrimidin-5-yl)quinazolin-4-one |
| SMILES | CCN(C)SNc1ccc(F)c(Oc2ccc3ncn(-c4cnc(N5CCNCC5)nc4)c(=O)c3c2)c1F |
| InChI | InChI=1S/C25H26F2N8O2S/c1-3-33(2)38-32-21-7-5-19(26)23(22(21)27)37-17-4-6-20-18(12-17)24(36)35(15-31-20)16-13-29-25(30-14-16)34-10-8-28-9-11-34/h4-7,12-15,28,32H,3,8-11H2,1-2H3 |
| InChIKey | JMRUHIUZZFLBJX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|