C10H16N2 — CID 166168982
(3E,5Z)-N,2-dimethyl-N-(methylideneamino)hepta-1,3,5-trien-3-amine (PubChem CID 166168982) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (3E,5Z)-N,2-dimethyl-N-(methylideneamino)hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-N,2-dimethyl-N-(methylideneamino)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 166168982 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (3E,5Z)-N,2-dimethyl-N-(methylideneamino)hepta-1,3,5-trien-3-amine |
| SMILES | C=NN(C)/C(=C/C=C\C)C(=C)C |
| InChI | InChI=1S/C10H16N2/c1-6-7-8-10(9(2)3)12(5)11-4/h6-8H,2,4H2,1,3,5H3/b7-6-,10-8+ |
| InChIKey | FFNZDOBAXJTJFZ-VAAURPRASA-N |
| XLogP | 2.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|