About S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine
S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine (PubChem CID 166169033) has the molecular formula C4H8F2N2S
and a molecular weight of 154.19 g/mol. Its IUPAC name is S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine.
Molecular Properties
| Compound Name | S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine |
| PubChem CID | 166169033 |
| Molecular Formula | C4H8F2N2S |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine |
| SMILES | NSN1CCC(F)(F)C1 |
| InChI | InChI=1S/C4H8F2N2S/c5-4(6)1-2-8(3-4)9-7/h1-3,7H2 |
| InChIKey | PYQGOMTVSQXCAS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine?
The IUPAC name of S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine (CID 166169033) is S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine.
What is the SMILES notation for S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine?
The canonical SMILES for S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine is NSN1CCC(F)(F)C1.
What is the InChIKey of S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine?
The InChIKey is PYQGOMTVSQXCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F2N2S/c5-4(6)1-2-8(3-4)9-7/h1-3,7H2.
What are the key properties of S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine?
S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine has a molecular weight of 154.19 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3,3-difluoropyrrolidin-1-yl)thiohydroxylamine is sourced from PubChem (CID 166169033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).